C7H12N2O — CID 127014466
3-hydroxy-2,2-dimethylpyrrolidine-1-carbonitrile (PubChem CID 127014466) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethylpyrrolidine-1-carbonitrile.
| Compound Name | 3-hydroxy-2,2-dimethylpyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 127014466 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 3-hydroxy-2,2-dimethylpyrrolidine-1-carbonitrile |
| SMILES | CC1(C)C(O)CCN1C#N |
| InChI | InChI=1S/C7H12N2O/c1-7(2)6(10)3-4-9(7)5-8/h6,10H,3-4H2,1-2H3 |
| InChIKey | PMAGJQFJWKVANP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|