C9H19NO2 — CID 117016800
1-(2-methoxyethyl)-2,2-dimethylpyrrolidin-3-ol (PubChem CID 117016800) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2,2-dimethylpyrrolidin-3-ol.
| Compound Name | 1-(2-methoxyethyl)-2,2-dimethylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 117016800 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 1-(2-methoxyethyl)-2,2-dimethylpyrrolidin-3-ol |
| SMILES | COCCN1CCC(O)C1(C)C |
| InChI | InChI=1S/C9H19NO2/c1-9(2)8(11)4-5-10(9)6-7-12-3/h8,11H,4-7H2,1-3H3 |
| InChIKey | NUUPMDBCNWYFDC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |