C11H23NO2 — CID 117019027
1-(3-methoxypropyl)-2,2-dimethylpiperidin-3-ol (PubChem CID 117019027) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2,2-dimethylpiperidin-3-ol.
| Compound Name | 1-(3-methoxypropyl)-2,2-dimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 117019027 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 1-(3-methoxypropyl)-2,2-dimethylpiperidin-3-ol |
| SMILES | COCCCN1CCCC(O)C1(C)C |
| InChI | InChI=1S/C11H23NO2/c1-11(2)10(13)6-4-7-12(11)8-5-9-14-3/h10,13H,4-9H2,1-3H3 |
| InChIKey | HEAKIFUSWZUJSL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|