C11H24N2O — CID 117019270
1-(2-methoxyethyl)-N,2,2-trimethylpiperidin-3-amine (PubChem CID 117019270) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N,2,2-trimethylpiperidin-3-amine.
| Compound Name | 1-(2-methoxyethyl)-N,2,2-trimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 117019270 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1-(2-methoxyethyl)-N,2,2-trimethylpiperidin-3-amine |
| SMILES | CNC1CCCN(CCOC)C1(C)C |
| InChI | InChI=1S/C11H24N2O/c1-11(2)10(12-3)6-5-7-13(11)8-9-14-4/h10,12H,5-9H2,1-4H3 |
| InChIKey | RPYGXTWFKOESEK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |