About 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid
1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid (PubChem CID 117017264) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid.
Analyze 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid (CID 117017264) is 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid is COCCN1CCC(C(=O)O)C1(C)C.
What is the InChIKey of 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid?
The InChIKey is GQGUNAPYJAFEMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-10(2)8(9(12)13)4-5-11(10)6-7-14-3/h8H,4-7H2,1-3H3,(H,12,13).
What are the key properties of 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid?
1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid has a molecular weight of 201.27 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-2,2-dimethylpyrrolidine-3-carboxylic acid is sourced from PubChem (CID 117017264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).