C11H24N2O — CID 117017613
[1-(3-methoxypropyl)-2,2-dimethylpyrrolidin-3-yl]methanamine (PubChem CID 117017613) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is [1-(3-methoxypropyl)-2,2-dimethylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(3-methoxypropyl)-2,2-dimethylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 117017613 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | [1-(3-methoxypropyl)-2,2-dimethylpyrrolidin-3-yl]methanamine |
| SMILES | COCCCN1CCC(CN)C1(C)C |
| InChI | InChI=1S/C11H24N2O/c1-11(2)10(9-12)5-7-13(11)6-4-8-14-3/h10H,4-9,12H2,1-3H3 |
| InChIKey | YFWBZNJSSBRDAK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|