C12H26N2O — CID 117018662
2-[1-(3-methoxypropyl)-5,5-dimethylpyrrolidin-3-yl]ethanamine (PubChem CID 117018662) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-[1-(3-methoxypropyl)-5,5-dimethylpyrrolidin-3-yl]ethanamine.
| Compound Name | 2-[1-(3-methoxypropyl)-5,5-dimethylpyrrolidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 117018662 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 2-[1-(3-methoxypropyl)-5,5-dimethylpyrrolidin-3-yl]ethanamine |
| SMILES | COCCCN1CC(CCN)CC1(C)C |
| InChI | InChI=1S/C12H26N2O/c1-12(2)9-11(5-6-13)10-14(12)7-4-8-15-3/h11H,4-10,13H2,1-3H3 |
| InChIKey | UFDNWEPNTUVSBY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|