C12H22N2O — CID 117020247
1-(3-methoxypropyl)-2,2-dimethylpiperidine-4-carbonitrile (PubChem CID 117020247) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2,2-dimethylpiperidine-4-carbonitrile.
| Compound Name | 1-(3-methoxypropyl)-2,2-dimethylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 117020247 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 1-(3-methoxypropyl)-2,2-dimethylpiperidine-4-carbonitrile |
| SMILES | COCCCN1CCC(C#N)CC1(C)C |
| InChI | InChI=1S/C12H22N2O/c1-12(2)9-11(10-13)5-7-14(12)6-4-8-15-3/h11H,4-9H2,1-3H3 |
| InChIKey | UXYMTMCWYSNTBQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|