C12H25NO2 — CID 117020669
[1-(3-methoxypropyl)-2,2-dimethylpiperidin-4-yl]methanol (PubChem CID 117020669) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is [1-(3-methoxypropyl)-2,2-dimethylpiperidin-4-yl]methanol.
| Compound Name | [1-(3-methoxypropyl)-2,2-dimethylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 117020669 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | [1-(3-methoxypropyl)-2,2-dimethylpiperidin-4-yl]methanol |
| SMILES | COCCCN1CCC(CO)CC1(C)C |
| InChI | InChI=1S/C12H25NO2/c1-12(2)9-11(10-14)5-7-13(12)6-4-8-15-3/h11,14H,4-10H2,1-3H3 |
| InChIKey | IFZHSSYGTIHNAG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|