C12H22BrNO — CID 131067156
1-[[1-(bromomethyl)cyclobutyl]methyl]-2,2-dimethylpyrrolidin-3-ol (PubChem CID 131067156) has the molecular formula C12H22BrNO and a molecular weight of 276.22 g/mol. Its IUPAC name is 1-[[1-(bromomethyl)cyclobutyl]methyl]-2,2-dimethylpyrrolidin-3-ol.
| Compound Name | 1-[[1-(bromomethyl)cyclobutyl]methyl]-2,2-dimethylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 131067156 |
| Molecular Formula | C12H22BrNO |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1-[[1-(bromomethyl)cyclobutyl]methyl]-2,2-dimethylpyrrolidin-3-ol |
| SMILES | CC1(C)C(O)CCN1CC1(CBr)CCC1 |
| InChI | InChI=1S/C12H22BrNO/c1-11(2)10(15)4-7-14(11)9-12(8-13)5-3-6-12/h10,15H,3-9H2,1-2H3 |
| InChIKey | KTCWOQUGUYOQIV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|