C12H22F4N2 — CID 112741495
2,2-diethyl-5-methyl-1-(2,2,3,3-tetrafluoropropyl)piperazine (PubChem CID 112741495) has the molecular formula C12H22F4N2 and a molecular weight of 270.31 g/mol. Its IUPAC name is 2,2-diethyl-5-methyl-1-(2,2,3,3-tetrafluoropropyl)piperazine.
| Compound Name | 2,2-diethyl-5-methyl-1-(2,2,3,3-tetrafluoropropyl)piperazine |
|---|---|
| PubChem CID | 112741495 |
| Molecular Formula | C12H22F4N2 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2,2-diethyl-5-methyl-1-(2,2,3,3-tetrafluoropropyl)piperazine |
| SMILES | CCC1(CC)CNC(C)CN1CC(F)(F)C(F)F |
| InChI | InChI=1S/C12H22F4N2/c1-4-11(5-2)7-17-9(3)6-18(11)8-12(15,16)10(13)14/h9-10,17H,4-8H2,1-3H3 |
| InChIKey | WOSCMARBZWHZSF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|