C13H26F2N2 — CID 64839847
1-(2,2-difluoroethyl)-2,2-diethyl-5-propan-2-ylpiperazine (PubChem CID 64839847) has the molecular formula C13H26F2N2 and a molecular weight of 248.36 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2,2-diethyl-5-propan-2-ylpiperazine.
| Compound Name | 1-(2,2-difluoroethyl)-2,2-diethyl-5-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 64839847 |
| Molecular Formula | C13H26F2N2 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2,2-diethyl-5-propan-2-ylpiperazine |
| SMILES | CCC1(CC)CNC(C(C)C)CN1CC(F)F |
| InChI | InChI=1S/C13H26F2N2/c1-5-13(6-2)9-16-11(10(3)4)7-17(13)8-12(14)15/h10-12,16H,5-9H2,1-4H3 |
| InChIKey | FOJURLBOKKULKD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |