C13H19FN2O3 — CID 106293013
1-[(3-fluoro-4-nitrophenyl)methylamino]-2-methylpentan-2-ol (PubChem CID 106293013) has the molecular formula C13H19FN2O3 and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-[(3-fluoro-4-nitrophenyl)methylamino]-2-methylpentan-2-ol.
| Compound Name | 1-[(3-fluoro-4-nitrophenyl)methylamino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 106293013 |
| Molecular Formula | C13H19FN2O3 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-[(3-fluoro-4-nitrophenyl)methylamino]-2-methylpentan-2-ol |
| SMILES | CCCC(C)(O)CNCc1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C13H19FN2O3/c1-3-6-13(2,17)9-15-8-10-4-5-12(16(18)19)11(14)7-10/h4-5,7,15,17H,3,6,8-9H2,1-2H3 |
| InChIKey | IICGUBSUBRVIFX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|