C13H19F2NO2 — CID 113251429
2,6-difluoro-4-[[(2-hydroxy-2-methylpentyl)amino]methyl]phenol (PubChem CID 113251429) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2,6-difluoro-4-[[(2-hydroxy-2-methylpentyl)amino]methyl]phenol.
| Compound Name | 2,6-difluoro-4-[[(2-hydroxy-2-methylpentyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 113251429 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2,6-difluoro-4-[[(2-hydroxy-2-methylpentyl)amino]methyl]phenol |
| SMILES | CCCC(C)(O)CNCc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C13H19F2NO2/c1-3-4-13(2,18)8-16-7-9-5-10(14)12(17)11(15)6-9/h5-6,16-18H,3-4,7-8H2,1-2H3 |
| InChIKey | RZGPVXGFBBZTDN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |