C13H19BrFNO — CID 103773692
1-[(4-bromo-3-fluorophenyl)methylamino]-2-methylpentan-2-ol (PubChem CID 103773692) has the molecular formula C13H19BrFNO and a molecular weight of 304.20 g/mol. Its IUPAC name is 1-[(4-bromo-3-fluorophenyl)methylamino]-2-methylpentan-2-ol.
| Compound Name | 1-[(4-bromo-3-fluorophenyl)methylamino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 103773692 |
| Molecular Formula | C13H19BrFNO |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1-[(4-bromo-3-fluorophenyl)methylamino]-2-methylpentan-2-ol |
| SMILES | CCCC(C)(O)CNCc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C13H19BrFNO/c1-3-6-13(2,17)9-16-8-10-4-5-11(14)12(15)7-10/h4-5,7,16-17H,3,6,8-9H2,1-2H3 |
| InChIKey | BQDHRYPWOHNASW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |