C9H18F4N2 — CID 106293632
3-methyl-1-N-(2,2,3,3-tetrafluoropropyl)pentane-1,2-diamine (PubChem CID 106293632) has the molecular formula C9H18F4N2 and a molecular weight of 230.25 g/mol. Its IUPAC name is 3-methyl-1-N-(2,2,3,3-tetrafluoropropyl)pentane-1,2-diamine.
| Compound Name | 3-methyl-1-N-(2,2,3,3-tetrafluoropropyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 106293632 |
| Molecular Formula | C9H18F4N2 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-methyl-1-N-(2,2,3,3-tetrafluoropropyl)pentane-1,2-diamine |
| SMILES | CCC(C)C(N)CNCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H18F4N2/c1-3-6(2)7(14)4-15-5-9(12,13)8(10)11/h6-8,15H,3-5,14H2,1-2H3 |
| InChIKey | FBZBMFMHLWXCFJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|