C9H13F4N3S — CID 106293897
N-[[2-(1-aminoethyl)-1,3-thiazol-4-yl]methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 106293897) has the molecular formula C9H13F4N3S and a molecular weight of 271.28 g/mol. Its IUPAC name is N-[[2-(1-aminoethyl)-1,3-thiazol-4-yl]methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[[2-(1-aminoethyl)-1,3-thiazol-4-yl]methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 106293897 |
| Molecular Formula | C9H13F4N3S |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[[2-(1-aminoethyl)-1,3-thiazol-4-yl]methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CC(N)c1nc(CNCC(F)(F)C(F)F)cs1 |
| InChI | InChI=1S/C9H13F4N3S/c1-5(14)7-16-6(3-17-7)2-15-4-9(12,13)8(10)11/h3,5,8,15H,2,4,14H2,1H3 |
| InChIKey | FQGYQVJRBIUNGJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|