C7H10F4N4 — CID 103529326
2,2,3,3-tetrafluoro-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine (PubChem CID 103529326) has the molecular formula C7H10F4N4 and a molecular weight of 226.18 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103529326 |
| Molecular Formula | C7H10F4N4 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(1-methyltriazol-4-yl)methyl]propan-1-amine |
| SMILES | Cn1cc(CNCC(F)(F)C(F)F)nn1 |
| InChI | InChI=1S/C7H10F4N4/c1-15-3-5(13-14-15)2-12-4-7(10,11)6(8)9/h3,6,12H,2,4H2,1H3 |
| InChIKey | CPQPZEFRTXEKQE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|