C9H10F4N2O2S — CID 106296025
methyl 2-[2-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 106296025) has the molecular formula C9H10F4N2O2S and a molecular weight of 286.25 g/mol. Its IUPAC name is methyl 2-[2-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 106296025 |
| Molecular Formula | C9H10F4N2O2S |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | methyl 2-[2-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H10F4N2O2S/c1-17-6(16)2-5-3-18-8(15-5)14-4-9(12,13)7(10)11/h3,7H,2,4H2,1H3,(H,14,15) |
| InChIKey | FOQBXRHRVTUATP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|