C11H18N4O3S — CID 83117388
methyl 2-[2-[2-(dimethylcarbamoylamino)ethylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 83117388) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is methyl 2-[2-[2-(dimethylcarbamoylamino)ethylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[2-(dimethylcarbamoylamino)ethylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 83117388 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | methyl 2-[2-[2-(dimethylcarbamoylamino)ethylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NCCNC(=O)N(C)C)n1 |
| InChI | InChI=1S/C11H18N4O3S/c1-15(2)11(17)13-5-4-12-10-14-8(7-19-10)6-9(16)18-3/h7H,4-6H2,1-3H3,(H,12,14)(H,13,17) |
| InChIKey | QXHGIXWFEGNHBI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|