C9H11F3N2O2S2 — CID 106433870
methyl 2-[2-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 106433870) has the molecular formula C9H11F3N2O2S2 and a molecular weight of 300.33 g/mol. Its IUPAC name is methyl 2-[2-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 106433870 |
| Molecular Formula | C9H11F3N2O2S2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | methyl 2-[2-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N2O2S2/c1-16-7(15)4-6-5-17-8(14-6)13-2-3-18-9(10,11)12/h5H,2-4H2,1H3,(H,13,14) |
| InChIKey | YWHAJCOMTYOFDS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|