C10H13F3N2O2S2 — CID 114188389
ethyl 2-[2-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 114188389) has the molecular formula C10H13F3N2O2S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is ethyl 2-[2-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 114188389 |
| Molecular Formula | C10H13F3N2O2S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | ethyl 2-[2-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2O2S2/c1-2-17-8(16)5-7-6-18-9(15-7)14-3-4-19-10(11,12)13/h6H,2-5H2,1H3,(H,14,15) |
| InChIKey | XKAKWCXIABXZDE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|