C13H22N2O3S — CID 82947003
ethyl 2-[2-(3-propoxypropylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 82947003) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is ethyl 2-[2-(3-propoxypropylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(3-propoxypropylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 82947003 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | ethyl 2-[2-(3-propoxypropylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCCOCCCNc1nc(CC(=O)OCC)cs1 |
| InChI | InChI=1S/C13H22N2O3S/c1-3-7-17-8-5-6-14-13-15-11(10-19-13)9-12(16)18-4-2/h10H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | OBEGIQQWDUONFG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|