C11H18N2O2S2 — CID 80576085
ethyl 2-[2-(3-methylsulfanylpropylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 80576085) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is ethyl 2-[2-(3-methylsulfanylpropylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(3-methylsulfanylpropylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 80576085 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | ethyl 2-[2-(3-methylsulfanylpropylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NCCCSC)n1 |
| InChI | InChI=1S/C11H18N2O2S2/c1-3-15-10(14)7-9-8-17-11(13-9)12-5-4-6-16-2/h8H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | ZJSMSRUCWWNJJA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|