C10H19N3O4 — CID 106298860
2-amino-N-[4-(hydroxymethyl)oxan-4-yl]butanediamide (PubChem CID 106298860) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-amino-N-[4-(hydroxymethyl)oxan-4-yl]butanediamide.
| Compound Name | 2-amino-N-[4-(hydroxymethyl)oxan-4-yl]butanediamide |
|---|---|
| PubChem CID | 106298860 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-amino-N-[4-(hydroxymethyl)oxan-4-yl]butanediamide |
| SMILES | NC(=O)CC(N)C(=O)NC1(CO)CCOCC1 |
| InChI | InChI=1S/C10H19N3O4/c11-7(5-8(12)15)9(16)13-10(6-14)1-3-17-4-2-10/h7,14H,1-6,11H2,(H2,12,15)(H,13,16) |
| InChIKey | SSJWRPPFWCWBSN-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |