C10H19NO5S — CID 104630382
N-[4-(hydroxymethyl)oxan-4-yl]-2-methylsulfonylpropanamide (PubChem CID 104630382) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)oxan-4-yl]-2-methylsulfonylpropanamide.
| Compound Name | N-[4-(hydroxymethyl)oxan-4-yl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104630382 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-[4-(hydroxymethyl)oxan-4-yl]-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)NC1(CO)CCOCC1)S(C)(=O)=O |
| InChI | InChI=1S/C10H19NO5S/c1-8(17(2,14)15)9(13)11-10(7-12)3-5-16-6-4-10/h8,12H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | RJVWPCJRTNDPQP-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |