C9H16BrNO3 — CID 106297187
2-bromo-N-[4-(hydroxymethyl)oxan-4-yl]propanamide (PubChem CID 106297187) has the molecular formula C9H16BrNO3 and a molecular weight of 266.13 g/mol. Its IUPAC name is 2-bromo-N-[4-(hydroxymethyl)oxan-4-yl]propanamide.
| Compound Name | 2-bromo-N-[4-(hydroxymethyl)oxan-4-yl]propanamide |
|---|---|
| PubChem CID | 106297187 |
| Molecular Formula | C9H16BrNO3 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2-bromo-N-[4-(hydroxymethyl)oxan-4-yl]propanamide |
| SMILES | CC(Br)C(=O)NC1(CO)CCOCC1 |
| InChI | InChI=1S/C9H16BrNO3/c1-7(10)8(13)11-9(6-12)2-4-14-5-3-9/h7,12H,2-6H2,1H3,(H,11,13) |
| InChIKey | AOKHQUMENXPWFM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|