C14H23NO3 — CID 170599713
(E,2Z)-2-ethylidene-N-[4-(hydroxymethyl)oxan-4-yl]-3-methylpent-3-enamide (PubChem CID 170599713) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is (E,2Z)-2-ethylidene-N-[4-(hydroxymethyl)oxan-4-yl]-3-methylpent-3-enamide.
| Compound Name | (E,2Z)-2-ethylidene-N-[4-(hydroxymethyl)oxan-4-yl]-3-methylpent-3-enamide |
|---|---|
| PubChem CID | 170599713 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (E,2Z)-2-ethylidene-N-[4-(hydroxymethyl)oxan-4-yl]-3-methylpent-3-enamide |
| SMILES | C/C=C(C(=O)NC1(CO)CCOCC1)/C(C)=C/C |
| InChI | InChI=1S/C14H23NO3/c1-4-11(3)12(5-2)13(17)15-14(10-16)6-8-18-9-7-14/h4-5,16H,6-10H2,1-3H3,(H,15,17)/b11-4+,12-5- |
| InChIKey | FWLRHBQSZCVADN-ZLSVCEQOSA-N |
| XLogP | 1.56 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|