C12H20N2O3 — CID 114170218
2-(azetidin-3-ylidene)-N-[4-(hydroxymethyl)oxan-4-yl]propanamide (PubChem CID 114170218) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-(azetidin-3-ylidene)-N-[4-(hydroxymethyl)oxan-4-yl]propanamide.
| Compound Name | 2-(azetidin-3-ylidene)-N-[4-(hydroxymethyl)oxan-4-yl]propanamide |
|---|---|
| PubChem CID | 114170218 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-(azetidin-3-ylidene)-N-[4-(hydroxymethyl)oxan-4-yl]propanamide |
| SMILES | CC(C(=O)NC1(CO)CCOCC1)=C1CNC1 |
| InChI | InChI=1S/C12H20N2O3/c1-9(10-6-13-7-10)11(16)14-12(8-15)2-4-17-5-3-12/h13,15H,2-8H2,1H3,(H,14,16) |
| InChIKey | CJOSQUDZYRIZLJ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|