C8H15N5O2 — CID 106299427
[4-[(1-methyltetrazol-5-yl)amino]oxan-4-yl]methanol (PubChem CID 106299427) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is [4-[(1-methyltetrazol-5-yl)amino]oxan-4-yl]methanol.
| Compound Name | [4-[(1-methyltetrazol-5-yl)amino]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106299427 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | [4-[(1-methyltetrazol-5-yl)amino]oxan-4-yl]methanol |
| SMILES | Cn1nnnc1NC1(CO)CCOCC1 |
| InChI | InChI=1S/C8H15N5O2/c1-13-7(10-11-12-13)9-8(6-14)2-4-15-5-3-8/h14H,2-6H2,1H3,(H,9,10,12) |
| InChIKey | JQJWJEGAVPYGTK-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |