C6H12N6 — CID 130942275
1-methyl-N-(3-methylazetidin-3-yl)tetrazol-5-amine (PubChem CID 130942275) has the molecular formula C6H12N6 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-methyl-N-(3-methylazetidin-3-yl)tetrazol-5-amine.
| Compound Name | 1-methyl-N-(3-methylazetidin-3-yl)tetrazol-5-amine |
|---|---|
| PubChem CID | 130942275 |
| Molecular Formula | C6H12N6 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 1-methyl-N-(3-methylazetidin-3-yl)tetrazol-5-amine |
| SMILES | Cn1nnnc1NC1(C)CNC1 |
| InChI | InChI=1S/C6H12N6/c1-6(3-7-4-6)8-5-9-10-11-12(5)2/h7H,3-4H2,1-2H3,(H,8,9,11) |
| InChIKey | BHGQJAQLXNWLDB-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |