About [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol
[4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol (PubChem CID 106299504) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol.
Molecular Properties
| Compound Name | [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol |
| PubChem CID | 106299504 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol |
| SMILES | OCC1(N2CC=CC2)CCOCC1 |
| InChI | InChI=1S/C10H17NO2/c12-9-10(3-7-13-8-4-10)11-5-1-2-6-11/h1-2,12H,3-9H2 |
| InChIKey | CAPQQHRIRKQPGT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol?
The IUPAC name of [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol (CID 106299504) is [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol.
What is the SMILES notation for [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol?
The canonical SMILES for [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol is OCC1(N2CC=CC2)CCOCC1.
What is the InChIKey of [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol?
The InChIKey is CAPQQHRIRKQPGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c12-9-10(3-7-13-8-4-10)11-5-1-2-6-11/h1-2,12H,3-9H2.
What are the key properties of [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol?
[4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol has a molecular weight of 183.25 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,5-dihydropyrrol-1-yl)oxan-4-yl]methanol is sourced from PubChem (CID 106299504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).