C16H22ClNO2 — CID 106300027
4-(chloromethyl)-N-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]oxan-4-amine (PubChem CID 106300027) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 4-(chloromethyl)-N-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]oxan-4-amine.
| Compound Name | 4-(chloromethyl)-N-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 106300027 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-(chloromethyl)-N-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]oxan-4-amine |
| SMILES | Cc1ccc2c(c1)CC(CNC1(CCl)CCOCC1)O2 |
| InChI | InChI=1S/C16H22ClNO2/c1-12-2-3-15-13(8-12)9-14(20-15)10-18-16(11-17)4-6-19-7-5-16/h2-3,8,14,18H,4-7,9-11H2,1H3 |
| InChIKey | OYHIWYXKEHXVDK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|