C14H21BrF3NO2 — CID 106300834
N-[4-(bromomethyl)oxan-4-yl]-4-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 106300834) has the molecular formula C14H21BrF3NO2 and a molecular weight of 372.23 g/mol. Its IUPAC name is N-[4-(bromomethyl)oxan-4-yl]-4-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[4-(bromomethyl)oxan-4-yl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106300834 |
| Molecular Formula | C14H21BrF3NO2 |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[4-(bromomethyl)oxan-4-yl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NC1(CBr)CCOCC1)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H21BrF3NO2/c15-9-13(5-7-21-8-6-13)19-12(20)10-1-3-11(4-2-10)14(16,17)18/h10-11H,1-9H2,(H,19,20) |
| InChIKey | AZAIWNBTOWKJDW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|