C12H20BrNO4S — CID 114170595
N-[4-(bromomethyl)oxan-4-yl]-1,1-dioxothiane-2-carboxamide (PubChem CID 114170595) has the molecular formula C12H20BrNO4S and a molecular weight of 354.27 g/mol. Its IUPAC name is N-[4-(bromomethyl)oxan-4-yl]-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-[4-(bromomethyl)oxan-4-yl]-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 114170595 |
| Molecular Formula | C12H20BrNO4S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-[4-(bromomethyl)oxan-4-yl]-1,1-dioxothiane-2-carboxamide |
| SMILES | O=C(NC1(CBr)CCOCC1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H20BrNO4S/c13-9-12(4-6-18-7-5-12)14-11(15)10-3-1-2-8-19(10,16)17/h10H,1-9H2,(H,14,15) |
| InChIKey | PUHYASQTELXPHM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|