C14H24N2O3S2 — CID 104519346
N-(1-carbamothioyl-4-methylcyclohexyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 104519346) has the molecular formula C14H24N2O3S2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-(1-carbamothioyl-4-methylcyclohexyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(1-carbamothioyl-4-methylcyclohexyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104519346 |
| Molecular Formula | C14H24N2O3S2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-(1-carbamothioyl-4-methylcyclohexyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | CC1CCC(NC(=O)C2CCCCS2(=O)=O)(C(N)=S)CC1 |
| InChI | InChI=1S/C14H24N2O3S2/c1-10-5-7-14(8-6-10,13(15)20)16-12(17)11-4-2-3-9-21(11,18)19/h10-11H,2-9H2,1H3,(H2,15,20)(H,16,17) |
| InChIKey | FDBGFVDKWILULQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|