C15H18BrNO3 — CID 106300971
N-[4-(bromomethyl)oxan-4-yl]-2,3-dihydro-1-benzofuran-3-carboxamide (PubChem CID 106300971) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is N-[4-(bromomethyl)oxan-4-yl]-2,3-dihydro-1-benzofuran-3-carboxamide.
| Compound Name | N-[4-(bromomethyl)oxan-4-yl]-2,3-dihydro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 106300971 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-[4-(bromomethyl)oxan-4-yl]-2,3-dihydro-1-benzofuran-3-carboxamide |
| SMILES | O=C(NC1(CBr)CCOCC1)C1COc2ccccc21 |
| InChI | InChI=1S/C15H18BrNO3/c16-10-15(5-7-19-8-6-15)17-14(18)12-9-20-13-4-2-1-3-11(12)13/h1-4,12H,5-10H2,(H,17,18) |
| InChIKey | LHYVCLKJOVRXRO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|