C21H25N3O5 — CID 167983743
N-[[1-(2,3-dihydro-1-benzofuran-3-carbonylamino)cyclopentyl]methyl]-2,6-dioxopiperidine-4-carboxamide (PubChem CID 167983743) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-[[1-(2,3-dihydro-1-benzofuran-3-carbonylamino)cyclopentyl]methyl]-2,6-dioxopiperidine-4-carboxamide.
| Compound Name | N-[[1-(2,3-dihydro-1-benzofuran-3-carbonylamino)cyclopentyl]methyl]-2,6-dioxopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 167983743 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-[[1-(2,3-dihydro-1-benzofuran-3-carbonylamino)cyclopentyl]methyl]-2,6-dioxopiperidine-4-carboxamide |
| SMILES | O=C1CC(C(=O)NCC2(NC(=O)C3COc4ccccc43)CCCC2)CC(=O)N1 |
| InChI | InChI=1S/C21H25N3O5/c25-17-9-13(10-18(26)23-17)19(27)22-12-21(7-3-4-8-21)24-20(28)15-11-29-16-6-2-1-5-14(15)16/h1-2,5-6,13,15H,3-4,7-12H2,(H,22,27)(H,24,28)(H,23,25,26) |
| InChIKey | JCCTUUZHLUIGQJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|