C12H17N7S — CID 106301775
3-ethyl-6-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 106301775) has the molecular formula C12H17N7S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-ethyl-6-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 3-ethyl-6-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 106301775 |
| Molecular Formula | C12H17N7S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 3-ethyl-6-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCc1nn(C)c2c1[nH]c(=S)n2Cc1nncn1CC |
| InChI | InChI=1S/C12H17N7S/c1-4-8-10-11(17(3)16-8)19(12(20)14-10)6-9-15-13-7-18(9)5-2/h7H,4-6H2,1-3H3,(H,14,20) |
| InChIKey | GXSJYGIFORNCKS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|