About methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate
methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate (PubChem CID 106303461) has the molecular formula C13H18N4O3
and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate |
| PubChem CID | 106303461 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate |
| SMILES | CCn1cnnc1CNC(C)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C13H18N4O3/c1-4-17-8-15-16-12(17)7-14-9(2)10-5-6-11(20-10)13(18)19-3/h5-6,8-9,14H,4,7H2,1-3H3 |
| InChIKey | IEFWQBLXETVCAH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate (CID 106303461) is methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate is CCn1cnnc1CNC(C)c1ccc(C(=O)OC)o1.
What is the InChIKey of methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate?
The InChIKey is IEFWQBLXETVCAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O3/c1-4-17-8-15-16-12(17)7-14-9(2)10-5-6-11(20-10)13(18)19-3/h5-6,8-9,14H,4,7H2,1-3H3.
What are the key properties of methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate?
methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate has a molecular weight of 278.31 g/mol, XLogP of 1.53, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[1-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]ethyl]furan-2-carboxylate is sourced from PubChem (CID 106303461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).