C7H12O2 — CID 10630501
(2S,3R,6R)-2,6-dimethyl-3,6-dihydro-2H-pyran-3-ol (PubChem CID 10630501) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is (2S,3R,6R)-2,6-dimethyl-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2S,3R,6R)-2,6-dimethyl-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 10630501 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (2S,3R,6R)-2,6-dimethyl-3,6-dihydro-2H-pyran-3-ol |
| SMILES | C[C@@H]1C=C[C@@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C7H12O2/c1-5-3-4-7(8)6(2)9-5/h3-8H,1-2H3/t5-,6+,7-/m1/s1 |
| InChIKey | NLOKNHKUHFSNCO-DSYKOEDSSA-N |
| XLogP | 0.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|