C7H12O2 — CID 10534676
(6-methyl-2,5-dihydropyran-6-yl)methanol (PubChem CID 10534676) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is (6-methyl-2,5-dihydropyran-6-yl)methanol.
| Compound Name | (6-methyl-2,5-dihydropyran-6-yl)methanol |
|---|---|
| PubChem CID | 10534676 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (6-methyl-2,5-dihydropyran-6-yl)methanol |
| SMILES | CC1(CO)CC=CCO1 |
| InChI | InChI=1S/C7H12O2/c1-7(6-8)4-2-3-5-9-7/h2-3,8H,4-6H2,1H3 |
| InChIKey | UETJYGNTHWAMGN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|