C12H21N3O3S — CID 106310313
6-[[2-(3-hydroxypropylsulfanyl)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 106310313) has the molecular formula C12H21N3O3S and a molecular weight of 287.39 g/mol. Its IUPAC name is 6-[[2-(3-hydroxypropylsulfanyl)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[[2-(3-hydroxypropylsulfanyl)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106310313 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 6-[[2-(3-hydroxypropylsulfanyl)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(CNCCSCCCO)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C12H21N3O3S/c1-14-10(8-11(17)15(2)12(14)18)9-13-4-7-19-6-3-5-16/h8,13,16H,3-7,9H2,1-2H3 |
| InChIKey | RQXJABMEPDRTAS-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|