C12H19N3O4S — CID 103767261
N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 103767261) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 103767261 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-(3-methyl-2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | Cn1c(=O)ccn(CC(=O)NCCSCCCO)c1=O |
| InChI | InChI=1S/C12H19N3O4S/c1-14-11(18)3-5-15(12(14)19)9-10(17)13-4-8-20-7-2-6-16/h3,5,16H,2,4,6-9H2,1H3,(H,13,17) |
| InChIKey | YHMDXACEUHLKHB-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|