C10H15N3O4S — CID 114171195
N-[2-(3-hydroxypropylsulfanyl)ethyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 114171195) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 114171195 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(NCCSCCCO)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N3O4S/c14-3-1-4-18-5-2-11-9(16)7-6-8(15)13-10(17)12-7/h6,14H,1-5H2,(H,11,16)(H2,12,13,15,17) |
| InChIKey | IETBUGTYIUDKJI-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|