C15H22N2O2S — CID 106311001
(3S)-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 106311001) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is (3S)-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3S)-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 106311001 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (3S)-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(NCCSCCCO)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C15H22N2O2S/c18-7-3-8-20-9-6-16-15(19)14-10-12-4-1-2-5-13(12)11-17-14/h1-2,4-5,14,17-18H,3,6-11H2,(H,16,19)/t14-/m0/s1 |
| InChIKey | TZQLYSWHLAZHMS-AWEZNQCLSA-N |
| XLogP | 0.93 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|