C13H24N2O — CID 106315106
N-ethyl-4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]oxolan-3-amine (PubChem CID 106315106) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-ethyl-4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]oxolan-3-amine.
| Compound Name | N-ethyl-4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 106315106 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-ethyl-4-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]oxolan-3-amine |
| SMILES | CCNC1COCC1CN1CCC=C(C)C1 |
| InChI | InChI=1S/C13H24N2O/c1-3-14-13-10-16-9-12(13)8-15-6-4-5-11(2)7-15/h5,12-14H,3-4,6-10H2,1-2H3 |
| InChIKey | JRZLMZJFFOHHGC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|