C15H20N2O2S — CID 106315307
6-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 106315307) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 6-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106315307 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 6-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1=CCCN(S(=O)(=O)c2ccc3c(c2)CCCN3)C1 |
| InChI | InChI=1S/C15H20N2O2S/c1-12-4-3-9-17(11-12)20(18,19)14-6-7-15-13(10-14)5-2-8-16-15/h4,6-7,10,16H,2-3,5,8-9,11H2,1H3 |
| InChIKey | LUHKNZBNOMKJOY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|