C14H20N2O3S — CID 43119875
2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine (PubChem CID 43119875) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine.
| Compound Name | 2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine |
|---|---|
| PubChem CID | 43119875 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-methyl-4-(1,2,3,4-tetrahydroquinolin-6-ylsulfonyl)morpholine |
| SMILES | CC1CN(S(=O)(=O)c2ccc3c(c2)CCCN3)CCO1 |
| InChI | InChI=1S/C14H20N2O3S/c1-11-10-16(7-8-19-11)20(17,18)13-4-5-14-12(9-13)3-2-6-15-14/h4-5,9,11,15H,2-3,6-8,10H2,1H3 |
| InChIKey | HVPVWTFWADKXDQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |