C12H12ClN3O3S2 — CID 106315626
4-chloro-N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1-methylpyrazole-5-sulfonamide (PubChem CID 106315626) has the molecular formula C12H12ClN3O3S2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 4-chloro-N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106315626 |
| Molecular Formula | C12H12ClN3O3S2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 4-chloro-N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)NCc1ccc(C#CCO)s1 |
| InChI | InChI=1S/C12H12ClN3O3S2/c1-16-12(11(13)8-14-16)21(18,19)15-7-10-5-4-9(20-10)3-2-6-17/h4-5,8,15,17H,6-7H2,1H3 |
| InChIKey | UVYFUZXFDYLRMP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|